9. Which transformation will place the trapezoid onto
itself?
(-2, 3)
(2, 3)
(-4, -3)
(4, -3)
A. Counterclockwise rotation about the origin by 90°
B. Rotation about the origin by 180°
C. Reflection across the x-axis
D. Reflection across the y - axis

Answers

Answer 1
Answer: B

The rotation will go back to the place where the trapezoid started

Related Questions

Answer Plz, ASAP. Within 10 minutes will be Marked as Brainliest ​

Answers

[tex]\large\bold{\underline{\underline{To \: Find:-}}}[/tex]

[tex] \sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=?[/tex]

[tex]\large\bold{\underline{\underline{Explanation:-}}}[/tex]

They are asking us to find the determinant

[tex]\boxed{\sf \left|\begin{array}{c c} a & b \\ c & d \end{array}\right| =ad-bc}[/tex]

Now using the above formula it becomes

[tex]\left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right| \: = sin20 \degree cos70 \degree - ( - cos20 \degree sin70 \degree) \: \\ \\ = sin20 \degree cos70 \degree + cos20 \degree sin70 \degree [/tex]

Now using the formula

[tex]\boxed{\sf sin(A+B)=sinAcosB+cosAsinB}[/tex]

it becomes

[tex] \longrightarrow \: sin(20 + 70) \\ \\ \longrightarrow \: sin(90 \degree) = 1[/tex]

★Therefore

[tex] \boxed{\sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=1}[/tex]

━━━━━━━━━━━━━━━━━━━

★Extra information:-

What is a matrix?

☄It is a rectangular representation or array of numbers,symbols and many more functions

☄It is represented in rows and columns

━━━━━━━━━━━━━━━━━━━━━━━━━━

the diagram shows two parallel lines cut by a transversal. If the measure of < 3 = ( 7y + 15) and the measure of < 5 = ( 110 - 2y) , what is the measure of <4​

Answers

Step-by-step explanation:

Angle 3 + Angle 5 = 180° (C-angles)

Therefore 7y + 15 + 110 - 2y = 180, 5y = 55, y = 11.

Angle 4 = Angle 5 (Z-angles)

Hence Angle 4 = 110 - 2y = 110 - 2(11) = 88°.

A line is perpendicular to y = 3x - 8
and intersects the point (2,2).
What is the equation of this
perpendicular line?

Answers

Since the line is perpendicular, we know that the slope is reciprocal and negative to the other one.

So,

y = -4x + b

We want to find the y-intersect (b) so substitute the intersected points and solve for it.

2 = -4(2) + b

2 = -8 + b

2 + 8 = b

10 = b

So the complete equation would be:

y = -4x + 10

PLEASE HELP ASSP !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

A: 2/9

Step-by-step explanation:

1) Graph the quadratic function given in standard form and identify the key features. Include at least 5 points on your
graph.
y=-x²-2x +1
Axis of Symmetry:
Vertex:
Y-intercept:
Domain:
Range:
Just question one plz help ASAP

Answers

Answer:

14

Step-by-step explanation:

Here are two rectangles.

Complete this sentence:

The two rectangles are similar and the scale factor is __

Answers

Answer:

It is

Scale Factor = Ratio of Side Lengths

= 12/8 = 9/6 = 1.5.

Step-by-step explanation:

Hope this helped have an amazing day!

The two rectangles are similar and the scale factor is 3/2.

Given data:

The first rectangle is represented as ABCD

The second rectangle is represented as PQRS

Now, the dimensions of ABCD is 8 cm x 6 cm

The dimensions of PQRS is 12 cm x 9 cm

So, the scale factor is represented as k and the value of k is :

k = length of PQRS / length of ABCD

So, k = 12 / 8

k = 3/2

Hence , the similar rectangles have a scale factor of 3/2

To learn more about rectangle click :

https://brainly.com/question/15225905

#SPJ2

Explain it too and is it x method?

Answers

Look when I factored this question I got 4(x+6)(x-8)
So Iam not sure either what the correct answer is but that’s what I got

TRAVEL It is about 350 miles from Ruidoso, New Mexico, to Abilene, Texas. Haruko has already driven 75 miles and made it to Roswell, New Mexico. She hopes to finish the rest of her trip, including stops, in 5 hours. Write an equation to find the average speed Haruko needs to drive to finish the rest of her trip in 5 hours.

Answers

Answer:

55 mph

Step-by-step explanation:

Given that:

Total miles of journey = 350 miles

Miles already driven = 75 miles

To cover the rest of the journey in 5 hours, the average speed of travel. Will be:

Recall:

Speed = (Distance left to cover ÷ budgeted travel time)

Distance left to cover : (total miles - distance already driven)

Average speed required = (350 - 75) / 5

= 275 / 5

= 55 mph

A classroom is 11 m long, 8 m wide and 5.5 m high Find the sum of the areas of the four walls.
( please show the working out pleaseee)​

Answers

Answer:

209 m²

Step-by-step explanation:

The class room has a measurement of 11 m long, 8 m wide and 5.5 m high. Hence the walls of the classroom would be 4, with the following measurements.

Wall 1: 11 m by 5.5 m, Wall 2: 8 m by 5.5 m, Wall 3: 11 m by 5.5 m and Wall 4: 8 m by 5.5 m

The area of wall 1 = 11 m * 5.5 m = 60.5 m²

The area of wall 2 = 8 m * 5.5 m = 44 m²

The area of wall 3 = 11 m * 5.5 m = 60.5 m²

The area of wall 4 = 11 m * 5.5 m = 44 m²

The sum of areas of the fall wall = area of wall 1 + area of wall 2 + area of wall 3 + area of wall 4

The sum of areas of the fall wall = 60.5 + 44 + 60.5 + 44 = 209 m²

A ball is thrown upward at an angle of 30° to the horizontal and lands on the top edge of a building that is 20 m away. The top edge is 5.0 m above the throwing point. How fast was the ball thrown? Use: sin30°=0.5 and cos30°=0.9
a. 20 m/s
b. 11 m/s
c. 52.3 m/s
d. 16 m/s​

Answers

Answer:

The correct option is;

a. 20 m/s

Step-by-step explanation:

The given parameters are;

The angle at which the ball is thrown, θ = 30° to the horizontal

The horizontal distance of the top edge of the building where the ball lands from where the ball is thrown, x = 20 m

The height of the top edge of the building above the throwing point = 5 meters

Let "v" represent the speed with which the ball is thrown

We have;

The vertical component of the speed with which the ball is thrown, [tex]v_y[/tex] = v × sin(θ) = v × sin(30°) = v × 0.5 = 0.5·v

[tex]v_y[/tex] = 0.5·v

The horizontal component of the speed with which the ball is thrown, vₓ = v × cos(θ) = v × cos(30°) = v × 0.9 = 0.9·v

vₓ = 0.9·v

The kinematic equation of the motion is y = [tex]v_y[/tex]·t - (1/2)·g·t², where;

y = The vertical height reached = 5 metes

t = The time taken to reach the specified 5 m, height

g = The acceleration due to gravity = 9.8 m/s², we have;

Therefore, we have;

5 = 0.5·v·t - (1/2)·9.8·t²...(1)

Also, from the horizontal motion of the ball, we have the following kinematic equation of motion;

x = vₓ × t

Therefore, by substituting the known values, we have;

20 = 0.9·v × t

∴ v = 20/(0.9·t) = 200/(9·t)...(2)

Substituting the value of t in equation (1) gives;

5 = 0.5·v·t - (1/2)·9.8·t² = 0.5·(200/(9·t))·t - (1/2)·9.8·t²

∴ 5 = 0.5·(200/(9·t))·t - (1/2)·9.8·t² = 100/9 - 4.9·t²

4.9·t² = 100/9 - 5 = 55/9

t = √(55/(9 × 4.9)) ≈ 1.116766

The time taken to reach the specified 5 m height = t ≈ 1.116766 seconds

From equation (2), we have, v = 200/(9·t) = 200/(9 × 1.116766) ≈ 19.8987 m/s

The speed with which the ball is thrown = v ≈ 19.8987 m/s ≈ 20 m/s. to the nearest whole number.

The speed with which the ball is thrown is approximately 20 m/s

Answer:

The answer is:

a) 20 m/s

Hope it helps:D

Suppose you know that the volume of the following prism is represent by V(x) = -2x^3 + 14x^2 + 120x.

Answers

Step-by-step explanation:

-2x³ + 14x² + 120x

= -2x(x² - 7x - 60)

= -2x(x - 12)(x + 5).

The other 2 dimensions are -2x and (x + 5).

When using a graphing calculator to maximise the volume of the prism, we get x = 7.378. However this value is not reasonable as it makes -2x and (x - 12) negative, which are the sides of the prism.

Help me on this math problem please! I’ve been stuck on it for 15 mins now

Answers

Answer:

Step-by-step explanation:

P = perimeter = 114

P =2 * length +2* width

P = 2(2x - 3) + 2(x)

114 =  4x-6  + 2x

114 = 6x -6

19 = x -1

20 = x

check it  

2( 2x -3)+2x =  ?  

4x -6 +2x=?

6x -6 = ?

6(20)-6 =?

120-6 = 114

yep this is correct

Kira is on her way home in her car. Her drive is 30 miles long. She has finished one-third of the drive so far. How far has she driven?

Answers

Answer:

10 miles

Step-by-step explanation:

1/3 × 30 miles = 10 miles

Answer:

Step-by-step explanation:

30 * 1/3 = 10  :)

think of an event that might occur at three different speeds and describe it.

Answers

Answer:

tornado!

Step-by-step explanation:

sometimes tornados can start off slow and sometimes they can go really fast.

PLEASE HELP
f(x) = x2. What is g(x)?

Answers

Answer: Choice C.  g(x) = (3x)^2

To confirm this, plug in x = 1 and you'll find that:

g(x) = (3x)^2

g(1) = (3*1)^2

g(1) = (3)^2

g(1) = 3*3

g(1) = 9

Showing that (1,9) is on the red g(x) curve.

How many solutions exist for the given equation?
1/2(x+12) = 4x - 1

Zero
One
Two
Infinitely many

Answers

Answer:

1

Step-by-step explanation:

Answer:

One

Step-by-step explanation:

[tex] \frac{1}{2} (x +12) = 4x - 1 \\ \\ \frac{1}{2} x + \frac{1}{2} \times 12 = 4x - 1 \\ \\ \frac{1}{2} x + 6 = 4x - 1 \\ \\ 6 + 1 = 4x - \frac{1}{2} x \\ \\ 7 = \frac{8x - x}{2} \\ \\ 7 = \frac{7}{2} x \\ \\ 7 \times 2 = 7x \\ \\ x = \frac{7 \times 2}{7} \\ \\ x = 2[/tex]

So, there exist only one solution for the given equation.

Solve.
y= 2x - 6
4x – 2y = 14
Use the substitution method.

Answers

Answer:

y=2x-6. ---------(1)

4x-2y=14. --------(2)

substituting equation 2 in 1

4x-2(2x-6)=14

4x-4x+12=14

so it has no solution

Step-by-step explanation:

As you can see in the image below, the answer is no solution.

|-4/5-1/10| + |-3/4+5/2|

A.) 9/10
B.) 53/20
C.) 7/4
D.) 17/10​

Answers

Answer:

B.) 53/20

General Formulas and Concepts:

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Algebra I

|Absolute Value| makes any negative number positive

Step-by-step explanation:

Step 1: Define

|-4/5 - 1/10| + |-3/4 + 5/2|

Step 2: Evaluate

Subtract:                    |-9/10| + |-3/4 + 5/2|Add:                           |-9/10| + |7/4|Absolute Value:        9/10 + 7/4Add:                           53/20

3/7 to its decimal form and rounded to the nearest thousandth

Answers

Answer:

Decimal form: 0.4286

Step-by-step explanation:

The value of 3/7 in decimal form up to nearest thousands will be 0.4285.

A fraction 3/7 is given in the question.

We have to find it's decimal form and round-off it to nearest thousands.

What will be the value of 1/2 in decimal form rounded to units place ?

The value will be 0.5

To find the decimal form let's divide 3 by 7.

3 ÷ 7 = 0.428572

We have to round it to nearest thousands i.e., up to 4 places Right to decimal point.

The rounded value will be 0.4285.

thus , the decimal form of 3/7 will be 0.4285 rounded off to nearest thousands.

To learn more about how to convert fraction to decimal click here ;

https://brainly.com/question/13635105

#SPJ2

Explain how to create an equation with infinity many solutions.

Answers

Make the equations have the same value
Example: 2(x+3) = 2x + 6

you need both sides of the equation to be equal to each other.

ex: 1 = 1

x = x

10 - x = -x + 10

this may not be what you're looking for and if it isn't just let me know

What is the interval notation for the compound inequality? x≤−4 or x≥5
(−∞, −4) or (5, ∞)
(−∞, −4] or [5, ∞)
(−4,5)
[−4,5]

Answers

Answer:

(-∞, -4] or [5, ∞)

Step-by-step explanation:

Because the solutions for x can also be equal to -4 and 5, brackets are used.

And because the solutions for x can be any number less than -4 or any number greater than 5, -∞ and ∞ are used respectively.

Have no idea how to do this lok

Answers

Answer:

that hard

Step-by-step explanation:

PLEASE HELPP
What is the solution to the following system of equations?

x − 3y = 6
2x + 2y = 4

(-1, 3)
(3, -1)
(1, -3)
(-3, 1)

Answers

Answer:

The solution to the system of equations be:

[tex]x=3,\:y=-1[/tex]

Hece, option B is correct.

Step-by-step explanation:

Given the system of equations

[tex]\begin{bmatrix}x-3y=6\\ 2x+2y=4\end{bmatrix}[/tex]

Multiply x − 3y = 6 by 2:      2x-6y=12

[tex]\begin{bmatrix}2x-6y=12\\ 2x+2y=4\end{bmatrix}[/tex]

so

[tex]2x+2y=4[/tex]

[tex]-[/tex]

[tex]\underline{2x-6y=12}[/tex]

[tex]8y=-8[/tex]

so the system of equations becomes

[tex]\begin{bmatrix}2x-6y=12\\ 8y=-8\end{bmatrix}[/tex]

Solve 8y = -8 for y

[tex]8y=-8[/tex]

Divide both sides by 8

[tex]\frac{8y}{8}=\frac{-8}{8}[/tex]

[tex]y=-1[/tex]

[tex]\mathrm{For\:}2x-6y=12\mathrm{\:plug\:in\:}y=-1[/tex]

[tex]2x-6\left(-1\right)=12[/tex]

[tex]2x+6=12[/tex]

subtract 6 from both sides

[tex]2x+6-6=12-6[/tex]

[tex]2x=6[/tex]

Divide both sides by 2

[tex]\frac{2x}{2}=\frac{6}{2}[/tex]

[tex]x=3[/tex]

Therefore, the solution to the system of equations be:

[tex]x=3,\:y=-1[/tex]

Hence, option B is correct.

A N S W E R :

x - 3y = 6 ......[Equation (i) ]2x + 2y = 4 ......[Equation (ii)]

⚽ From Equation (i) we get :

x = 6 + 3y......[Equation (iii)]

⚽ Now, Substitute the equation (iii) in equation (ii) we get :

→ 2(6 + 3y) + 2y = 4

→ 12 + 6y + 2y = 4

→ 8y = 4 - 12

→ 8y = -8

→ y = -8 ÷ 8

y = -1

⚽ Now Substituting value of y = -1 in equation (iii) we get :

→ x = 6 + 3y

→ x = 6 + 3(-1)

→ x = 6 + (-3)

→ x = 6 - 3

x = 3

Hence,the value of x = 3 and value of y = -1.

What is 5 billion times 0

Answers

Answer:

0

Step-by-step explanation:

Anything multiplied by 0 is 0

BC = 17.89
DC = 16
with reference to the figure sin x=?
a.0.250
b. 0.447
c.0.894
d. 1

Answers

Answer:

c

Step-by-step explanation:

The value of sin x in the given right triangle is 0.894.

What sine of an angle?

The sine of an angle is a trigonometric function that is defined as the ratio of the length of the side opposite the angle to the length of the hypotenuse in a right triangle.

Given is right triangle ABC, we need to find the value of sin x,

So, we see that the figure is divided into three similar triangles,

Namely,

Δ CDB ~ Δ BDA ~ Δ CBA,

Therefore, according to the definition of similarity,

We have,

CD / CB = BD / BA = 16/17.89

Therefore, BD / BA = 0.894

Also,

sin x = BD / BA

Therefore,

sin x = 0.894

Hence the value of sin x in the given right triangle is 0.894.

Learn more about sine of an angle, click;

https://brainly.com/question/3827723

#SPJ7

What is the expression shown

Answers

Answer:

There is nothing but your question and you should try on your own

Step-by-step explanation:

Answer:

N/A

Step-by-step explanation:

There is not context with this problem, therefore it cannot be solved.

Express 0.000000000936 in
scientific notation.
9.36x10
Enter

Answers

Answer:

9.36 x 10^(-10)

Step-by-step explanation:

help!!

Find the solution of the system of equations
shown on the graph.

Answers

Answer:

(0,6)

Step-by-step explanation:

When a system of equations is graphed, the point at which the lines intersect is a solution to the system. Looking at the graph, we can see that the lines intersect at (0,6). Therefore, (0,6) is a solution to the system of equations.

Work out the Value of the missing fraction 1/7+ ?=1/3

Answers

Step-by-step explanation:

1/7 + ? = 1/3

? = 1/3 - 1/7 = 7/21 - 3/21 = 4/21.

The missing fraction is 4/21.

In the figure, point C is the midpoint of (A/E) Use the figure to answer the questions.

Avery says that AbC /DeC by the ASA congruence postulate. Do you agree or disagree Explain?
Suppose it is also known that point C is also the midpoint of (B/D Which postulate or theorem can be used to prove that aBC/DeC? Justify your answer.

Answers

Answer:

Disagree ΔABC ≅ ΔDEC by ASA butt by SAS

Step-by-step explanation:

point C is the midpoint of (A/E), C is also the midpoint of (B/D )

BC = CD   and AC = CE

∠BCA = ∠ECD

ΔABC ≅ ΔDEC by SAS not by ASA

Other Questions
Calculate the number of moles in 125g of Copper (II) Hydroxide. URGENT! Ellie fills her car with 14.297 gallons of gas. Alivia fills her car with 14.209 gallons of gas.write an inequality statement comparing the two gas purchase. Jean spent $37.50 for 500 paperclips. How much did he pay for each paperclip? Which group in the Roman Republic's government had powers similar to a king's but served only one year? O A. Citizens O B. Consuls O C. Tribunes O D. Senators explain any 3 basic necessities of a family. Which information from paragraph 1 is further developed by the details in paragraph 4?Answer choices for the above questionThe concept that minimalism can lead to adventureThe requirements of the minimalist lifestyleThe reason minimalism is extremely popular with youthThe ways a minimalist lifestyle can improve finances What is the effect of Morrison naming the brand of vacuum cleaner? In the work you do, the person yu are A(n) _________ is an Internet-based firm that specializes in the secure electronic transfer of funds. anyone help!!!!! he due in 30 4) 300cm of Hydrogen chloride gas were passed over 7.0g of heated iron fillings until there was no furtherchange. The reaction vessel was then allowed to cool to room temperature. Use the equation below todetermine the mass of iron that remained at the end of the experiment (molar gas volume = 24000cm"; Fe=56).Fe(s) + 2HCl(g) FeCl2(s) + H2(g)(3 mks)503 of IM colution calcium chloride (Avogadro's The diameter of a pearl is about 4 x 10-3cm and the diameter of an atom is about10-11m. How much larger than an atom is a pearl?Show your work.a)14x 10-14times b) 4 x 10 -14timesc) 14x 10-11times d) 4 x 106times PLEASE HELP ME ASAP PLEASEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEE (02.03 HC) Explain how scientists use geologic time to determine the age of landforms. (3 points) If Zoe has 9 apples, and each apple were 9 grams of sugar. How many grams of sugar does Zoe ate if see eats 9 apples each day this week. Of the volunteers donating blood in a clinic, 30% have the Rhesus (Rh) factor present in their blood. (a) If five volunteers are randomly selected, what is the probability that at least one does not have the Rh factor Is it estuvo or estaba Complete each sentence below with the correct form of the most logical verb in parentheses.Los amigos(aprender/comer) en la cafetera de la escuela.Yo(recibir/ver) a mi amigo Juan en la sala de clase.(beber/leer) t helado en el caf.Uds. (leer/comprender) cu ando el profesor habla?El alumno(comprender escribir) en el cuaderno.Catalina y yoNosotros(vivir/ver) en Mxicot (aprender/recibir) notas buenas en la clase de matemticas?QuUd.? Un libro de espaol. (comprender/leer)La familia Lpez(beber'vivir) en un apartamento grande.Las alumnas argentinas(aprender comer) el ingls I need help Please. the question in photo Can someone help me with this Guys should I buy a male or female Maltese dog?And why please help urgent asap